C21H25Cl2NO4 — CID 19880708
[4-[1-chloro-2-(methylamino)ethyl]-2-(2-methylpropanoyloxy)phenyl] 4-methylbenzoate;hydrochloride (PubChem CID 19880708) has the molecular formula C21H25Cl2NO4 and a molecular weight of 426.34 g/mol. Its IUPAC name is [4-[1-chloro-2-(methylamino)ethyl]-2-(2-methylpropanoyloxy)phenyl] 4-methylbenzoate;hydrochloride.
| Compound Name | [4-[1-chloro-2-(methylamino)ethyl]-2-(2-methylpropanoyloxy)phenyl] 4-methylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 19880708 |
| Molecular Formula | C21H25Cl2NO4 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | [4-[1-chloro-2-(methylamino)ethyl]-2-(2-methylpropanoyloxy)phenyl] 4-methylbenzoate;hydrochloride |
| SMILES | CNCC(Cl)c1ccc(OC(=O)c2ccc(C)cc2)c(OC(=O)C(C)C)c1.Cl |
| InChI | InChI=1S/C21H24ClNO4.ClH/c1-13(2)20(24)27-19-11-16(17(22)12-23-4)9-10-18(19)26-21(25)15-7-5-14(3)6-8-15;/h5-11,13,17,23H,12H2,1-4H3;1H |
| InChIKey | KZNDXEFGQPBVEN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|