C14H22Cl2N2O5S — CID 19880685
[5-(2-amino-1-chloroethyl)-2-(dimethylsulfamoyloxy)phenyl] 2-methylpropanoate;hydrochloride (PubChem CID 19880685) has the molecular formula C14H22Cl2N2O5S and a molecular weight of 401.31 g/mol. Its IUPAC name is [5-(2-amino-1-chloroethyl)-2-(dimethylsulfamoyloxy)phenyl] 2-methylpropanoate;hydrochloride.
| Compound Name | [5-(2-amino-1-chloroethyl)-2-(dimethylsulfamoyloxy)phenyl] 2-methylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 19880685 |
| Molecular Formula | C14H22Cl2N2O5S |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | [5-(2-amino-1-chloroethyl)-2-(dimethylsulfamoyloxy)phenyl] 2-methylpropanoate;hydrochloride |
| SMILES | CC(C)C(=O)Oc1cc(C(Cl)CN)ccc1OS(=O)(=O)N(C)C.Cl |
| InChI | InChI=1S/C14H21ClN2O5S.ClH/c1-9(2)14(18)21-13-7-10(11(15)8-16)5-6-12(13)22-23(19,20)17(3)4;/h5-7,9,11H,8,16H2,1-4H3;1H |
| InChIKey | TWBMDQMYDVYTFY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|