C23H28N2O8S — CID 19880670
[2-(dimethylsulfamoyloxy)-5-[2-[methyl(phenylmethoxycarbonyl)amino]acetyl]phenyl] 2-methylpropanoate (PubChem CID 19880670) has the molecular formula C23H28N2O8S and a molecular weight of 492.55 g/mol. Its IUPAC name is [2-(dimethylsulfamoyloxy)-5-[2-[methyl(phenylmethoxycarbonyl)amino]acetyl]phenyl] 2-methylpropanoate.
| Compound Name | [2-(dimethylsulfamoyloxy)-5-[2-[methyl(phenylmethoxycarbonyl)amino]acetyl]phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 19880670 |
| Molecular Formula | C23H28N2O8S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | [2-(dimethylsulfamoyloxy)-5-[2-[methyl(phenylmethoxycarbonyl)amino]acetyl]phenyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)Oc1cc(C(=O)CN(C)C(=O)OCc2ccccc2)ccc1OS(=O)(=O)N(C)C |
| InChI | InChI=1S/C23H28N2O8S/c1-16(2)22(27)32-21-13-18(11-12-20(21)33-34(29,30)24(3)4)19(26)14-25(5)23(28)31-15-17-9-7-6-8-10-17/h6-13,16H,14-15H2,1-5H3 |
| InChIKey | OMCSDXGTWQUXMV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|