C31H29NO5 — CID 146186944
benzyl N-[2-[3,4-bis(phenylmethoxy)phenyl]-2-oxoethyl]-N-methylcarbamate (PubChem CID 146186944) has the molecular formula C31H29NO5 and a molecular weight of 495.58 g/mol. Its IUPAC name is benzyl N-[2-[3,4-bis(phenylmethoxy)phenyl]-2-oxoethyl]-N-methylcarbamate.
| Compound Name | benzyl N-[2-[3,4-bis(phenylmethoxy)phenyl]-2-oxoethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 146186944 |
| Molecular Formula | C31H29NO5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | benzyl N-[2-[3,4-bis(phenylmethoxy)phenyl]-2-oxoethyl]-N-methylcarbamate |
| SMILES | CN(CC(=O)c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H29NO5/c1-32(31(34)37-23-26-15-9-4-10-16-26)20-28(33)27-17-18-29(35-21-24-11-5-2-6-12-24)30(19-27)36-22-25-13-7-3-8-14-25/h2-19H,20-23H2,1H3 |
| InChIKey | BDGNHXKTSYXJMU-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |