C38H38NO9P — CID 70445524
benzyl N-[2-(4-hydroxy-3-phenylmethoxyphenyl)-2-oxoethyl]-N-methylcarbamate;dibenzyl hydrogen phosphate (PubChem CID 70445524) has the molecular formula C38H38NO9P and a molecular weight of 683.69 g/mol. Its IUPAC name is benzyl N-[2-(4-hydroxy-3-phenylmethoxyphenyl)-2-oxoethyl]-N-methylcarbamate;dibenzyl hydrogen phosphate.
| Compound Name | benzyl N-[2-(4-hydroxy-3-phenylmethoxyphenyl)-2-oxoethyl]-N-methylcarbamate;dibenzyl hydrogen phosphate |
|---|---|
| PubChem CID | 70445524 |
| Molecular Formula | C38H38NO9P |
| Molecular Weight | 683.69 g/mol |
| Exact Mass | 683.23 |
| IUPAC Name | benzyl N-[2-(4-hydroxy-3-phenylmethoxyphenyl)-2-oxoethyl]-N-methylcarbamate;dibenzyl hydrogen phosphate |
| SMILES | CN(CC(=O)c1ccc(O)c(OCc2ccccc2)c1)C(=O)OCc1ccccc1.O=P(O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C24H23NO5.C14H15O4P/c1-25(24(28)30-17-19-10-6-3-7-11-19)15-22(27)20-12-13-21(26)23(14-20)29-16-18-8-4-2-5-9-18;15-19(16,17-11-13-7-3-1-4-8-13)18-12-14-9-5-2-6-10-14/h2-14,26H,15-17H2,1H3;1-10H,11-12H2,(H,15,16) |
| InChIKey | JPVPPRCPHQSXHB-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.69 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|