C25H23NO6 — CID 54271109
[2-hydroxy-5-[[methyl(phenacyl)carbamoyl]oxymethyl]phenyl] 4-methylbenzoate (PubChem CID 54271109) has the molecular formula C25H23NO6 and a molecular weight of 433.46 g/mol. Its IUPAC name is [2-hydroxy-5-[[methyl(phenacyl)carbamoyl]oxymethyl]phenyl] 4-methylbenzoate.
| Compound Name | [2-hydroxy-5-[[methyl(phenacyl)carbamoyl]oxymethyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 54271109 |
| Molecular Formula | C25H23NO6 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | [2-hydroxy-5-[[methyl(phenacyl)carbamoyl]oxymethyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2cc(COC(=O)N(C)CC(=O)c3ccccc3)ccc2O)cc1 |
| InChI | InChI=1S/C25H23NO6/c1-17-8-11-20(12-9-17)24(29)32-23-14-18(10-13-21(23)27)16-31-25(30)26(2)15-22(28)19-6-4-3-5-7-19/h3-14,27H,15-16H2,1-2H3 |
| InChIKey | RKEQGXDQASWGQF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|