C19H20Cl2O5 — CID 175220092
[5-[1-(3,5-dimethoxyphenyl)ethyl]-2-methoxyphenyl] 2,2-dichloroacetate (PubChem CID 175220092) has the molecular formula C19H20Cl2O5 and a molecular weight of 399.27 g/mol. Its IUPAC name is [5-[1-(3,5-dimethoxyphenyl)ethyl]-2-methoxyphenyl] 2,2-dichloroacetate.
| Compound Name | [5-[1-(3,5-dimethoxyphenyl)ethyl]-2-methoxyphenyl] 2,2-dichloroacetate |
|---|---|
| PubChem CID | 175220092 |
| Molecular Formula | C19H20Cl2O5 |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | [5-[1-(3,5-dimethoxyphenyl)ethyl]-2-methoxyphenyl] 2,2-dichloroacetate |
| SMILES | COc1cc(OC)cc(C(C)c2ccc(OC)c(OC(=O)C(Cl)Cl)c2)c1 |
| InChI | InChI=1S/C19H20Cl2O5/c1-11(13-7-14(23-2)10-15(8-13)24-3)12-5-6-16(25-4)17(9-12)26-19(22)18(20)21/h5-11,18H,1-4H3 |
| InChIKey | ZGARVPWQOGRUAS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|