C15H18Cl4N2O4 — CID 18890069
2,2-dichloro-N-[[(2,2-dichloroacetyl)amino]-(4-methoxy-3-propan-2-yloxyphenyl)methyl]acetamide (PubChem CID 18890069) has the molecular formula C15H18Cl4N2O4 and a molecular weight of 432.13 g/mol. Its IUPAC name is 2,2-dichloro-N-[[(2,2-dichloroacetyl)amino]-(4-methoxy-3-propan-2-yloxyphenyl)methyl]acetamide.
| Compound Name | 2,2-dichloro-N-[[(2,2-dichloroacetyl)amino]-(4-methoxy-3-propan-2-yloxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 18890069 |
| Molecular Formula | C15H18Cl4N2O4 |
| Molecular Weight | 432.13 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | 2,2-dichloro-N-[[(2,2-dichloroacetyl)amino]-(4-methoxy-3-propan-2-yloxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(C(NC(=O)C(Cl)Cl)NC(=O)C(Cl)Cl)cc1OC(C)C |
| InChI | InChI=1S/C15H18Cl4N2O4/c1-7(2)25-10-6-8(4-5-9(10)24-3)13(20-14(22)11(16)17)21-15(23)12(18)19/h4-7,11-13H,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | MDVPRPBLGIZWLS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.13 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|