C18H22O5 — CID 129391240
(S)-(3,5-dimethoxyphenyl)-(3-ethoxy-4-methoxyphenyl)methanol (PubChem CID 129391240) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is (S)-(3,5-dimethoxyphenyl)-(3-ethoxy-4-methoxyphenyl)methanol.
| Compound Name | (S)-(3,5-dimethoxyphenyl)-(3-ethoxy-4-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 129391240 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | (S)-(3,5-dimethoxyphenyl)-(3-ethoxy-4-methoxyphenyl)methanol |
| SMILES | CCOc1cc([C@H](O)c2cc(OC)cc(OC)c2)ccc1OC |
| InChI | InChI=1S/C18H22O5/c1-5-23-17-10-12(6-7-16(17)22-4)18(19)13-8-14(20-2)11-15(9-13)21-3/h6-11,18-19H,5H2,1-4H3/t18-/m0/s1 |
| InChIKey | HJQPFUZLJPKKDC-SFHVURJKSA-N |
| XLogP | 3.19 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |