C17H16F4O5 — CID 129391775
(R)-[3,4-bis(difluoromethoxy)phenyl]-(3,5-dimethoxyphenyl)methanol (PubChem CID 129391775) has the molecular formula C17H16F4O5 and a molecular weight of 376.30 g/mol. Its IUPAC name is (R)-[3,4-bis(difluoromethoxy)phenyl]-(3,5-dimethoxyphenyl)methanol.
| Compound Name | (R)-[3,4-bis(difluoromethoxy)phenyl]-(3,5-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 129391775 |
| Molecular Formula | C17H16F4O5 |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | (R)-[3,4-bis(difluoromethoxy)phenyl]-(3,5-dimethoxyphenyl)methanol |
| SMILES | COc1cc(OC)cc([C@H](O)c2ccc(OC(F)F)c(OC(F)F)c2)c1 |
| InChI | InChI=1S/C17H16F4O5/c1-23-11-5-10(6-12(8-11)24-2)15(22)9-3-4-13(25-16(18)19)14(7-9)26-17(20)21/h3-8,15-17,22H,1-2H3/t15-/m1/s1 |
| InChIKey | QMXCMNSSWLLYOM-OAHLLOKOSA-N |
| XLogP | 3.99 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |