C14H10BrF4NO3 — CID 129382065
(R)-[3,4-bis(difluoromethoxy)phenyl]-(6-bromo-3-pyridinyl)methanol (PubChem CID 129382065) has the molecular formula C14H10BrF4NO3 and a molecular weight of 396.13 g/mol. Its IUPAC name is (R)-[3,4-bis(difluoromethoxy)phenyl]-(6-bromo-3-pyridinyl)methanol.
| Compound Name | (R)-[3,4-bis(difluoromethoxy)phenyl]-(6-bromo-3-pyridinyl)methanol |
|---|---|
| PubChem CID | 129382065 |
| Molecular Formula | C14H10BrF4NO3 |
| Molecular Weight | 396.13 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | (R)-[3,4-bis(difluoromethoxy)phenyl]-(6-bromo-3-pyridinyl)methanol |
| SMILES | O[C@@H](c1ccc(Br)nc1)c1ccc(OC(F)F)c(OC(F)F)c1 |
| InChI | InChI=1S/C14H10BrF4NO3/c15-11-4-2-8(6-20-11)12(21)7-1-3-9(22-13(16)17)10(5-7)23-14(18)19/h1-6,12-14,21H/t12-/m1/s1 |
| InChIKey | UTAUAGAGGSNWOI-GFCCVEGCSA-N |
| XLogP | 4.13 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.13 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|