C13H16O5 — CID 141140451
1,3-dioxol-4-yl-(3-ethoxy-4-methoxyphenyl)methanol (PubChem CID 141140451) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is 1,3-dioxol-4-yl-(3-ethoxy-4-methoxyphenyl)methanol.
| Compound Name | 1,3-dioxol-4-yl-(3-ethoxy-4-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 141140451 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 1,3-dioxol-4-yl-(3-ethoxy-4-methoxyphenyl)methanol |
| SMILES | CCOc1cc(C(O)C2=COCO2)ccc1OC |
| InChI | InChI=1S/C13H16O5/c1-3-17-11-6-9(4-5-10(11)15-2)13(14)12-7-16-8-18-12/h4-7,13-14H,3,8H2,1-2H3 |
| InChIKey | ZINKWZYRHQQKND-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |