C11H13ClO4 — CID 94376627
methyl (2R)-2-chloro-2-(3,5-dimethoxyphenyl)acetate (PubChem CID 94376627) has the molecular formula C11H13ClO4 and a molecular weight of 244.67 g/mol. Its IUPAC name is methyl (2R)-2-chloro-2-(3,5-dimethoxyphenyl)acetate.
| Compound Name | methyl (2R)-2-chloro-2-(3,5-dimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 94376627 |
| Molecular Formula | C11H13ClO4 |
| Molecular Weight | 244.67 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | methyl (2R)-2-chloro-2-(3,5-dimethoxyphenyl)acetate |
| SMILES | COC(=O)[C@H](Cl)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C11H13ClO4/c1-14-8-4-7(5-9(6-8)15-2)10(12)11(13)16-3/h4-6,10H,1-3H3/t10-/m1/s1 |
| InChIKey | RWNHCMSKBLURNY-SNVBAGLBSA-N |
| XLogP | 2.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.67 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|