methyl (2R)-2-chloro-2-(3,5-dimethoxyphenyl)acetate

C11H13ClO4 — CID 94376627

IUPACmethyl (2R)-2-chloro-2-(3,5-dimethoxyphenyl)acetate
SMILESCOC(=O)[C@H](Cl)c1cc(OC)cc(OC)c1
InChIInChI=1S/C11H13ClO4/c1-14-8-4-7(5-9(6-8)15-2)10(12)11(13)16-3/h4-6,10H,1-3H3/t10-/m1/s1
InChIKeyRWNHCMSKBLURNY-SNVBAGLBSA-N
MW244.67 g/mol
LogP2.16
Rot. Bonds4

About methyl (2R)-2-chloro-2-(3,5-dimethoxyphenyl)acetate

methyl (2R)-2-chloro-2-(3,5-dimethoxyphenyl)acetate (PubChem CID 94376627) has the molecular formula C11H13ClO4 and a molecular weight of 244.67 g/mol. Its IUPAC name is methyl (2R)-2-chloro-2-(3,5-dimethoxyphenyl)acetate.

Molecular Properties

Compound Namemethyl (2R)-2-chloro-2-(3,5-dimethoxyphenyl)acetate
PubChem CID94376627
Molecular FormulaC11H13ClO4
Molecular Weight244.67 g/mol
Exact Mass244.05
IUPAC Namemethyl (2R)-2-chloro-2-(3,5-dimethoxyphenyl)acetate
SMILESCOC(=O)[C@H](Cl)c1cc(OC)cc(OC)c1
InChIInChI=1S/C11H13ClO4/c1-14-8-4-7(5-9(6-8)15-2)10(12)11(13)16-3/h4-6,10H,1-3H3/t10-/m1/s1
InChIKeyRWNHCMSKBLURNY-SNVBAGLBSA-N
XLogP2.16
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.67
LogP ≤ 52.16
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze methyl (2R)-2-chloro-2-(3,5-dimethoxyphenyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2R)-2-chloro-2-(3,5-dimethoxyphenyl)acetate?
The IUPAC name of methyl (2R)-2-chloro-2-(3,5-dimethoxyphenyl)acetate (CID 94376627) is methyl (2R)-2-chloro-2-(3,5-dimethoxyphenyl)acetate.
What is the SMILES notation for methyl (2R)-2-chloro-2-(3,5-dimethoxyphenyl)acetate?
The canonical SMILES for methyl (2R)-2-chloro-2-(3,5-dimethoxyphenyl)acetate is COC(=O)[C@H](Cl)c1cc(OC)cc(OC)c1.
What is the InChIKey of methyl (2R)-2-chloro-2-(3,5-dimethoxyphenyl)acetate?
The InChIKey is RWNHCMSKBLURNY-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H13ClO4/c1-14-8-4-7(5-9(6-8)15-2)10(12)11(13)16-3/h4-6,10H,1-3H3/t10-/m1/s1.
What are the key properties of methyl (2R)-2-chloro-2-(3,5-dimethoxyphenyl)acetate?
methyl (2R)-2-chloro-2-(3,5-dimethoxyphenyl)acetate has a molecular weight of 244.67 g/mol, XLogP of 2.16, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-chloro-2-(3,5-dimethoxyphenyl)acetate is sourced from PubChem (CID 94376627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).