C13H16ClNO3 — CID 55048151
2-chloro-N-cyclopropyl-2-(3,5-dimethoxyphenyl)acetamide (PubChem CID 55048151) has the molecular formula C13H16ClNO3 and a molecular weight of 269.73 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-2-(3,5-dimethoxyphenyl)acetamide.
| Compound Name | 2-chloro-N-cyclopropyl-2-(3,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 55048151 |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-chloro-N-cyclopropyl-2-(3,5-dimethoxyphenyl)acetamide |
| SMILES | COc1cc(OC)cc(C(Cl)C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C13H16ClNO3/c1-17-10-5-8(6-11(7-10)18-2)12(14)13(16)15-9-3-4-9/h5-7,9,12H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | ACJDBAWXWRQOGV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|