C9H12ClN3O — CID 62225884
2-chloro-N-cyclopropyl-2-(1-methylpyrazol-4-yl)acetamide (PubChem CID 62225884) has the molecular formula C9H12ClN3O and a molecular weight of 213.67 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-2-(1-methylpyrazol-4-yl)acetamide.
| Compound Name | 2-chloro-N-cyclopropyl-2-(1-methylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 62225884 |
| Molecular Formula | C9H12ClN3O |
| Molecular Weight | 213.67 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 2-chloro-N-cyclopropyl-2-(1-methylpyrazol-4-yl)acetamide |
| SMILES | Cn1cc(C(Cl)C(=O)NC2CC2)cn1 |
| InChI | InChI=1S/C9H12ClN3O/c1-13-5-6(4-11-13)8(10)9(14)12-7-2-3-7/h4-5,7-8H,2-3H2,1H3,(H,12,14) |
| InChIKey | MQMZIPVGZPPLJA-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.67 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|