C22H29NO6 — CID 89122705
[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethyl]phenyl] 2-(dimethylamino)acetate (PubChem CID 89122705) has the molecular formula C22H29NO6 and a molecular weight of 403.48 g/mol. Its IUPAC name is [2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethyl]phenyl] 2-(dimethylamino)acetate.
| Compound Name | [2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethyl]phenyl] 2-(dimethylamino)acetate |
|---|---|
| PubChem CID | 89122705 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | [2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethyl]phenyl] 2-(dimethylamino)acetate |
| SMILES | COc1ccc(C(C)c2cc(OC)c(OC)c(OC)c2)cc1OC(=O)CN(C)C |
| InChI | InChI=1S/C22H29NO6/c1-14(16-11-19(26-5)22(28-7)20(12-16)27-6)15-8-9-17(25-4)18(10-15)29-21(24)13-23(2)3/h8-12,14H,13H2,1-7H3 |
| InChIKey | IYDRWUXIYKYTPM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|