C22H28O5 — CID 68873086
(2-methyl-5-propan-2-ylphenyl) 3-(3,4,5-trimethoxyphenyl)propanoate (PubChem CID 68873086) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is (2-methyl-5-propan-2-ylphenyl) 3-(3,4,5-trimethoxyphenyl)propanoate.
| Compound Name | (2-methyl-5-propan-2-ylphenyl) 3-(3,4,5-trimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 68873086 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (2-methyl-5-propan-2-ylphenyl) 3-(3,4,5-trimethoxyphenyl)propanoate |
| SMILES | COc1cc(CCC(=O)Oc2cc(C(C)C)ccc2C)cc(OC)c1OC |
| InChI | InChI=1S/C22H28O5/c1-14(2)17-9-7-15(3)18(13-17)27-21(23)10-8-16-11-19(24-4)22(26-6)20(12-16)25-5/h7,9,11-14H,8,10H2,1-6H3 |
| InChIKey | PBTHUZBZBBNFJA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|