C29H29NO7 — CID 88611313
[5-[1-hydroxy-2-[2-oxoethenyl(phenylmethoxy)amino]ethyl]-2-(2-methylpropanoyloxy)phenyl] 4-methylbenzoate (PubChem CID 88611313) has the molecular formula C29H29NO7 and a molecular weight of 503.55 g/mol. Its IUPAC name is [5-[1-hydroxy-2-[2-oxoethenyl(phenylmethoxy)amino]ethyl]-2-(2-methylpropanoyloxy)phenyl] 4-methylbenzoate.
| Compound Name | [5-[1-hydroxy-2-[2-oxoethenyl(phenylmethoxy)amino]ethyl]-2-(2-methylpropanoyloxy)phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 88611313 |
| Molecular Formula | C29H29NO7 |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | [5-[1-hydroxy-2-[2-oxoethenyl(phenylmethoxy)amino]ethyl]-2-(2-methylpropanoyloxy)phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2cc(C(O)CN(C=C=O)OCc3ccccc3)ccc2OC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C29H29NO7/c1-20(2)28(33)36-26-14-13-24(17-27(26)37-29(34)23-11-9-21(3)10-12-23)25(32)18-30(15-16-31)35-19-22-7-5-4-6-8-22/h4-15,17,20,25,32H,18-19H2,1-3H3 |
| InChIKey | KPXRYAOJWRGRIX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|