C34H51NO8S — CID 88755111
[4-(2-amino-3,3-dimethyl-1-methylsulfonyloxybutyl)-2-[2-(4-propan-2-yloxyphenyl)acetyl]oxyphenyl] 7,7-dimethyloctanoate (PubChem CID 88755111) has the molecular formula C34H51NO8S and a molecular weight of 633.85 g/mol. Its IUPAC name is [4-(2-amino-3,3-dimethyl-1-methylsulfonyloxybutyl)-2-[2-(4-propan-2-yloxyphenyl)acetyl]oxyphenyl] 7,7-dimethyloctanoate.
| Compound Name | [4-(2-amino-3,3-dimethyl-1-methylsulfonyloxybutyl)-2-[2-(4-propan-2-yloxyphenyl)acetyl]oxyphenyl] 7,7-dimethyloctanoate |
|---|---|
| PubChem CID | 88755111 |
| Molecular Formula | C34H51NO8S |
| Molecular Weight | 633.85 g/mol |
| Exact Mass | 633.33 |
| IUPAC Name | [4-(2-amino-3,3-dimethyl-1-methylsulfonyloxybutyl)-2-[2-(4-propan-2-yloxyphenyl)acetyl]oxyphenyl] 7,7-dimethyloctanoate |
| SMILES | CC(C)Oc1ccc(CC(=O)Oc2cc(C(OS(C)(=O)=O)C(N)C(C)(C)C)ccc2OC(=O)CCCCCC(C)(C)C)cc1 |
| InChI | InChI=1S/C34H51NO8S/c1-23(2)40-26-17-14-24(15-18-26)21-30(37)42-28-22-25(31(43-44(9,38)39)32(35)34(6,7)8)16-19-27(28)41-29(36)13-11-10-12-20-33(3,4)5/h14-19,22-23,31-32H,10-13,20-21,35H2,1-9H3 |
| InChIKey | BMMZBIGCSQQWBP-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.85 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|