C30H33NO7 — CID 70554372
[4-(2-amino-3,3-dimethylbutanoyl)-2-[2-(4-methoxyphenyl)acetyl]oxyphenyl] 2-(4-methoxyphenyl)acetate (PubChem CID 70554372) has the molecular formula C30H33NO7 and a molecular weight of 519.59 g/mol. Its IUPAC name is [4-(2-amino-3,3-dimethylbutanoyl)-2-[2-(4-methoxyphenyl)acetyl]oxyphenyl] 2-(4-methoxyphenyl)acetate.
| Compound Name | [4-(2-amino-3,3-dimethylbutanoyl)-2-[2-(4-methoxyphenyl)acetyl]oxyphenyl] 2-(4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 70554372 |
| Molecular Formula | C30H33NO7 |
| Molecular Weight | 519.59 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | [4-(2-amino-3,3-dimethylbutanoyl)-2-[2-(4-methoxyphenyl)acetyl]oxyphenyl] 2-(4-methoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)Oc2ccc(C(=O)C(N)C(C)(C)C)cc2OC(=O)Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H33NO7/c1-30(2,3)29(31)28(34)21-10-15-24(37-26(32)16-19-6-11-22(35-4)12-7-19)25(18-21)38-27(33)17-20-8-13-23(36-5)14-9-20/h6-15,18,29H,16-17,31H2,1-5H3 |
| InChIKey | XJACVTQGTHZJNF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|