C30H33NO5 — CID 70553751
[4-(2-amino-3,3-dimethylbutanoyl)-2-(3-phenylpropanoyloxy)phenyl] 3-phenylpropanoate (PubChem CID 70553751) has the molecular formula C30H33NO5 and a molecular weight of 487.60 g/mol. Its IUPAC name is [4-(2-amino-3,3-dimethylbutanoyl)-2-(3-phenylpropanoyloxy)phenyl] 3-phenylpropanoate.
| Compound Name | [4-(2-amino-3,3-dimethylbutanoyl)-2-(3-phenylpropanoyloxy)phenyl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 70553751 |
| Molecular Formula | C30H33NO5 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | [4-(2-amino-3,3-dimethylbutanoyl)-2-(3-phenylpropanoyloxy)phenyl] 3-phenylpropanoate |
| SMILES | CC(C)(C)C(N)C(=O)c1ccc(OC(=O)CCc2ccccc2)c(OC(=O)CCc2ccccc2)c1 |
| InChI | InChI=1S/C30H33NO5/c1-30(2,3)29(31)28(34)23-16-17-24(35-26(32)18-14-21-10-6-4-7-11-21)25(20-23)36-27(33)19-15-22-12-8-5-9-13-22/h4-13,16-17,20,29H,14-15,18-19,31H2,1-3H3 |
| InChIKey | BBISBGZEKYMNJG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|