C24H33NO5 — CID 70554470
[4-(2-amino-3,3-dimethylbutanoyl)-2-(cyclopentanecarbonyloxy)phenyl] cyclopentanecarboxylate (PubChem CID 70554470) has the molecular formula C24H33NO5 and a molecular weight of 415.53 g/mol. Its IUPAC name is [4-(2-amino-3,3-dimethylbutanoyl)-2-(cyclopentanecarbonyloxy)phenyl] cyclopentanecarboxylate.
| Compound Name | [4-(2-amino-3,3-dimethylbutanoyl)-2-(cyclopentanecarbonyloxy)phenyl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 70554470 |
| Molecular Formula | C24H33NO5 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | [4-(2-amino-3,3-dimethylbutanoyl)-2-(cyclopentanecarbonyloxy)phenyl] cyclopentanecarboxylate |
| SMILES | CC(C)(C)C(N)C(=O)c1ccc(OC(=O)C2CCCC2)c(OC(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C24H33NO5/c1-24(2,3)21(25)20(26)17-12-13-18(29-22(27)15-8-4-5-9-15)19(14-17)30-23(28)16-10-6-7-11-16/h12-16,21H,4-11,25H2,1-3H3 |
| InChIKey | OZFOVJUAUKULJY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|