C34H53NO9S — CID 88755115
[4-[2-(tert-butylamino)-1-hydroxyethyl]-2-[2-(4-propan-2-yloxyphenyl)acetyl]oxyphenyl] 7,7-dimethyloctanoate;methanesulfonic acid (PubChem CID 88755115) has the molecular formula C34H53NO9S and a molecular weight of 651.86 g/mol. Its IUPAC name is [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-[2-(4-propan-2-yloxyphenyl)acetyl]oxyphenyl] 7,7-dimethyloctanoate;methanesulfonic acid.
| Compound Name | [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-[2-(4-propan-2-yloxyphenyl)acetyl]oxyphenyl] 7,7-dimethyloctanoate;methanesulfonic acid |
|---|---|
| PubChem CID | 88755115 |
| Molecular Formula | C34H53NO9S |
| Molecular Weight | 651.86 g/mol |
| Exact Mass | 651.34 |
| IUPAC Name | [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-[2-(4-propan-2-yloxyphenyl)acetyl]oxyphenyl] 7,7-dimethyloctanoate;methanesulfonic acid |
| SMILES | CC(C)Oc1ccc(CC(=O)Oc2cc(C(O)CNC(C)(C)C)ccc2OC(=O)CCCCCC(C)(C)C)cc1.CS(=O)(=O)O |
| InChI | InChI=1S/C33H49NO6.CH4O3S/c1-23(2)38-26-16-13-24(14-17-26)20-31(37)40-29-21-25(27(35)22-34-33(6,7)8)15-18-28(29)39-30(36)12-10-9-11-19-32(3,4)5;1-5(2,3)4/h13-18,21,23,27,34-35H,9-12,19-20,22H2,1-8H3;1H3,(H,2,3,4) |
| InChIKey | QVWUBDQHQPHPIQ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 148.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.86 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|