C22H37NO4 — CID 54402014
[4-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxyphenyl] 7,7-dimethyloctanoate (PubChem CID 54402014) has the molecular formula C22H37NO4 and a molecular weight of 379.54 g/mol. Its IUPAC name is [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxyphenyl] 7,7-dimethyloctanoate.
| Compound Name | [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxyphenyl] 7,7-dimethyloctanoate |
|---|---|
| PubChem CID | 54402014 |
| Molecular Formula | C22H37NO4 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxyphenyl] 7,7-dimethyloctanoate |
| SMILES | CC(C)(C)CCCCCC(=O)Oc1ccc(C(O)CNC(C)(C)C)cc1O |
| InChI | InChI=1S/C22H37NO4/c1-21(2,3)13-9-7-8-10-20(26)27-19-12-11-16(14-17(19)24)18(25)15-23-22(4,5)6/h11-12,14,18,23-25H,7-10,13,15H2,1-6H3 |
| InChIKey | VOBRWXKLYFNKLK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|