C9H9ClO2 — CID 174727966
chloro 3,4-dimethylbenzoate (PubChem CID 174727966) has the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. Its IUPAC name is chloro 3,4-dimethylbenzoate.
| Compound Name | chloro 3,4-dimethylbenzoate |
|---|---|
| PubChem CID | 174727966 |
| Molecular Formula | C9H9ClO2 |
| Molecular Weight | 184.62 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | chloro 3,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)OCl)cc1C |
| InChI | InChI=1S/C9H9ClO2/c1-6-3-4-8(5-7(6)2)9(11)12-10/h3-5H,1-2H3 |
| InChIKey | YCPOLCPIRMQUJB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.62 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |