C15H20O5 — CID 130399817
2-(2-acetyloxyethoxy)ethyl 3,4-dimethylbenzoate (PubChem CID 130399817) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-(2-acetyloxyethoxy)ethyl 3,4-dimethylbenzoate.
| Compound Name | 2-(2-acetyloxyethoxy)ethyl 3,4-dimethylbenzoate |
|---|---|
| PubChem CID | 130399817 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-(2-acetyloxyethoxy)ethyl 3,4-dimethylbenzoate |
| SMILES | CC(=O)OCCOCCOC(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H20O5/c1-11-4-5-14(10-12(11)2)15(17)20-9-7-18-6-8-19-13(3)16/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | RGLGFCZVGWUZEB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|