About 2-(2-hydroxyethoxy)ethyl 4-amino-3-methylbenzoate
2-(2-hydroxyethoxy)ethyl 4-amino-3-methylbenzoate (PubChem CID 61321259) has the molecular formula C12H17NO4
and a molecular weight of 239.27 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl 4-amino-3-methylbenzoate.
Molecular Properties
| Compound Name | 2-(2-hydroxyethoxy)ethyl 4-amino-3-methylbenzoate |
| PubChem CID | 61321259 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl 4-amino-3-methylbenzoate |
| SMILES | Cc1cc(C(=O)OCCOCCO)ccc1N |
| InChI | InChI=1S/C12H17NO4/c1-9-8-10(2-3-11(9)13)12(15)17-7-6-16-5-4-14/h2-3,8,14H,4-7,13H2,1H3 |
| InChIKey | BBMDWLGMKCWADZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyethoxy)ethyl 4-amino-3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethoxy)ethyl 4-amino-3-methylbenzoate?
The IUPAC name of 2-(2-hydroxyethoxy)ethyl 4-amino-3-methylbenzoate (CID 61321259) is 2-(2-hydroxyethoxy)ethyl 4-amino-3-methylbenzoate.
What is the SMILES notation for 2-(2-hydroxyethoxy)ethyl 4-amino-3-methylbenzoate?
The canonical SMILES for 2-(2-hydroxyethoxy)ethyl 4-amino-3-methylbenzoate is Cc1cc(C(=O)OCCOCCO)ccc1N.
What is the InChIKey of 2-(2-hydroxyethoxy)ethyl 4-amino-3-methylbenzoate?
The InChIKey is BBMDWLGMKCWADZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO4/c1-9-8-10(2-3-11(9)13)12(15)17-7-6-16-5-4-14/h2-3,8,14H,4-7,13H2,1H3.
What are the key properties of 2-(2-hydroxyethoxy)ethyl 4-amino-3-methylbenzoate?
2-(2-hydroxyethoxy)ethyl 4-amino-3-methylbenzoate has a molecular weight of 239.27 g/mol, XLogP of 0.74, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethoxy)ethyl 4-amino-3-methylbenzoate is sourced from PubChem (CID 61321259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).