C19H23NO4 — CID 130399793
2-[2-(pyridin-2-ylmethoxy)ethoxy]ethyl 3,4-dimethylbenzoate (PubChem CID 130399793) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-[2-(pyridin-2-ylmethoxy)ethoxy]ethyl 3,4-dimethylbenzoate.
| Compound Name | 2-[2-(pyridin-2-ylmethoxy)ethoxy]ethyl 3,4-dimethylbenzoate |
|---|---|
| PubChem CID | 130399793 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2-[2-(pyridin-2-ylmethoxy)ethoxy]ethyl 3,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)OCCOCCOCc2ccccn2)cc1C |
| InChI | InChI=1S/C19H23NO4/c1-15-6-7-17(13-16(15)2)19(21)24-12-11-22-9-10-23-14-18-5-3-4-8-20-18/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | YLAGTNJJLWJWAR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|