C29H33NO7S — CID 54024645
[2-benzoyloxy-4-[4-(tert-butylamino)-1-methylsulfonyloxybutyl]phenyl] benzoate (PubChem CID 54024645) has the molecular formula C29H33NO7S and a molecular weight of 539.65 g/mol. Its IUPAC name is [2-benzoyloxy-4-[4-(tert-butylamino)-1-methylsulfonyloxybutyl]phenyl] benzoate.
| Compound Name | [2-benzoyloxy-4-[4-(tert-butylamino)-1-methylsulfonyloxybutyl]phenyl] benzoate |
|---|---|
| PubChem CID | 54024645 |
| Molecular Formula | C29H33NO7S |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | [2-benzoyloxy-4-[4-(tert-butylamino)-1-methylsulfonyloxybutyl]phenyl] benzoate |
| SMILES | CC(C)(C)NCCCC(OS(C)(=O)=O)c1ccc(OC(=O)c2ccccc2)c(OC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C29H33NO7S/c1-29(2,3)30-19-11-16-24(37-38(4,33)34)23-17-18-25(35-27(31)21-12-7-5-8-13-21)26(20-23)36-28(32)22-14-9-6-10-15-22/h5-10,12-15,17-18,20,24,30H,11,16,19H2,1-4H3 |
| InChIKey | LBHXPEZNXZALQT-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|