C27H33NO5S — CID 54383627
[1-[3,4-bis(3-methylphenoxy)phenyl]-2-(tert-butylamino)ethyl] methanesulfonate (PubChem CID 54383627) has the molecular formula C27H33NO5S and a molecular weight of 483.63 g/mol. Its IUPAC name is [1-[3,4-bis(3-methylphenoxy)phenyl]-2-(tert-butylamino)ethyl] methanesulfonate.
| Compound Name | [1-[3,4-bis(3-methylphenoxy)phenyl]-2-(tert-butylamino)ethyl] methanesulfonate |
|---|---|
| PubChem CID | 54383627 |
| Molecular Formula | C27H33NO5S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | [1-[3,4-bis(3-methylphenoxy)phenyl]-2-(tert-butylamino)ethyl] methanesulfonate |
| SMILES | Cc1cccc(Oc2ccc(C(CNC(C)(C)C)OS(C)(=O)=O)cc2Oc2cccc(C)c2)c1 |
| InChI | InChI=1S/C27H33NO5S/c1-19-9-7-11-22(15-19)31-24-14-13-21(17-25(24)32-23-12-8-10-20(2)16-23)26(33-34(6,29)30)18-28-27(3,4)5/h7-17,26,28H,18H2,1-6H3 |
| InChIKey | VBRQASWNZAETPR-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|