C27H33NO5S — CID 57098170
2-[3,4-bis(2-methylphenoxy)phenyl]-3-(tert-butylamino)propane-1-sulfonic acid (PubChem CID 57098170) has the molecular formula C27H33NO5S and a molecular weight of 483.63 g/mol. Its IUPAC name is 2-[3,4-bis(2-methylphenoxy)phenyl]-3-(tert-butylamino)propane-1-sulfonic acid.
| Compound Name | 2-[3,4-bis(2-methylphenoxy)phenyl]-3-(tert-butylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 57098170 |
| Molecular Formula | C27H33NO5S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 2-[3,4-bis(2-methylphenoxy)phenyl]-3-(tert-butylamino)propane-1-sulfonic acid |
| SMILES | Cc1ccccc1Oc1ccc(C(CNC(C)(C)C)CS(=O)(=O)O)cc1Oc1ccccc1C |
| InChI | InChI=1S/C27H33NO5S/c1-19-10-6-8-12-23(19)32-25-15-14-21(16-26(25)33-24-13-9-7-11-20(24)2)22(18-34(29,30)31)17-28-27(3,4)5/h6-16,22,28H,17-18H2,1-5H3,(H,29,30,31) |
| InChIKey | CCBJRDJIEZPOII-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|