C24H32N2O5 — CID 142700257
[4-[3-(dimethylamino)-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2-methoxyphenyl] benzoate (PubChem CID 142700257) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is [4-[3-(dimethylamino)-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2-methoxyphenyl] benzoate.
| Compound Name | [4-[3-(dimethylamino)-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2-methoxyphenyl] benzoate |
|---|---|
| PubChem CID | 142700257 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | [4-[3-(dimethylamino)-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2-methoxyphenyl] benzoate |
| SMILES | COc1cc(C(CCN(C)C)NC(=O)OC(C)(C)C)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H32N2O5/c1-24(2,3)31-23(28)25-19(14-15-26(4)5)18-12-13-20(21(16-18)29-6)30-22(27)17-10-8-7-9-11-17/h7-13,16,19H,14-15H2,1-6H3,(H,25,28) |
| InChIKey | VIDKGBWGTXNVBD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|