C24H36N4O2 — CID 118198666
tert-butyl N-[2-anilino-1-[4-[2-(dimethylamino)ethyl-methylamino]phenyl]ethyl]carbamate (PubChem CID 118198666) has the molecular formula C24H36N4O2 and a molecular weight of 412.58 g/mol. Its IUPAC name is tert-butyl N-[2-anilino-1-[4-[2-(dimethylamino)ethyl-methylamino]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-anilino-1-[4-[2-(dimethylamino)ethyl-methylamino]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 118198666 |
| Molecular Formula | C24H36N4O2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | tert-butyl N-[2-anilino-1-[4-[2-(dimethylamino)ethyl-methylamino]phenyl]ethyl]carbamate |
| SMILES | CN(C)CCN(C)c1ccc(C(CNc2ccccc2)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H36N4O2/c1-24(2,3)30-23(29)26-22(18-25-20-10-8-7-9-11-20)19-12-14-21(15-13-19)28(6)17-16-27(4)5/h7-15,22,25H,16-18H2,1-6H3,(H,26,29) |
| InChIKey | PPPDALOPUFRWON-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|