C27H33NO8S — CID 88753442
[5-[2-(tert-butylamino)acetyl]-2-(4-methylphenoxy)phenyl] benzoate;methanesulfonic acid;hydrate (PubChem CID 88753442) has the molecular formula C27H33NO8S and a molecular weight of 531.63 g/mol. Its IUPAC name is [5-[2-(tert-butylamino)acetyl]-2-(4-methylphenoxy)phenyl] benzoate;methanesulfonic acid;hydrate.
| Compound Name | [5-[2-(tert-butylamino)acetyl]-2-(4-methylphenoxy)phenyl] benzoate;methanesulfonic acid;hydrate |
|---|---|
| PubChem CID | 88753442 |
| Molecular Formula | C27H33NO8S |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | [5-[2-(tert-butylamino)acetyl]-2-(4-methylphenoxy)phenyl] benzoate;methanesulfonic acid;hydrate |
| SMILES | CS(=O)(=O)O.Cc1ccc(Oc2ccc(C(=O)CNC(C)(C)C)cc2OC(=O)c2ccccc2)cc1.O |
| InChI | InChI=1S/C26H27NO4.CH4O3S.H2O/c1-18-10-13-21(14-11-18)30-23-15-12-20(22(28)17-27-26(2,3)4)16-24(23)31-25(29)19-8-6-5-7-9-19;1-5(2,3)4;/h5-16,27H,17H2,1-4H3;1H3,(H,2,3,4);1H2 |
| InChIKey | CTHTUWVBICWDII-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 150.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|