C21H25NO4 — CID 54457261
[4-[2-(tert-butylamino)acetyl]-2-(4-methylphenoxy)phenyl] acetate (PubChem CID 54457261) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is [4-[2-(tert-butylamino)acetyl]-2-(4-methylphenoxy)phenyl] acetate.
| Compound Name | [4-[2-(tert-butylamino)acetyl]-2-(4-methylphenoxy)phenyl] acetate |
|---|---|
| PubChem CID | 54457261 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | [4-[2-(tert-butylamino)acetyl]-2-(4-methylphenoxy)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)CNC(C)(C)C)cc1Oc1ccc(C)cc1 |
| InChI | InChI=1S/C21H25NO4/c1-14-6-9-17(10-7-14)26-20-12-16(8-11-19(20)25-15(2)23)18(24)13-22-21(3,4)5/h6-12,22H,13H2,1-5H3 |
| InChIKey | WZBUJKUMWRGMHZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|