C22H21NO3 — CID 70624105
2-amino-1-[3,4-bis(4-methylphenoxy)phenyl]ethanone (PubChem CID 70624105) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is 2-amino-1-[3,4-bis(4-methylphenoxy)phenyl]ethanone.
| Compound Name | 2-amino-1-[3,4-bis(4-methylphenoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 70624105 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-amino-1-[3,4-bis(4-methylphenoxy)phenyl]ethanone |
| SMILES | Cc1ccc(Oc2ccc(C(=O)CN)cc2Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H21NO3/c1-15-3-8-18(9-4-15)25-21-12-7-17(20(24)14-23)13-22(21)26-19-10-5-16(2)6-11-19/h3-13H,14,23H2,1-2H3 |
| InChIKey | OBIPALJZXVGTCA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |