C27H31NO3 — CID 54154091
1-[3,4-bis(4-methylphenoxy)phenyl]-2-(tert-butylamino)propan-1-one (PubChem CID 54154091) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is 1-[3,4-bis(4-methylphenoxy)phenyl]-2-(tert-butylamino)propan-1-one.
| Compound Name | 1-[3,4-bis(4-methylphenoxy)phenyl]-2-(tert-butylamino)propan-1-one |
|---|---|
| PubChem CID | 54154091 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 1-[3,4-bis(4-methylphenoxy)phenyl]-2-(tert-butylamino)propan-1-one |
| SMILES | Cc1ccc(Oc2ccc(C(=O)C(C)NC(C)(C)C)cc2Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H31NO3/c1-18-7-12-22(13-8-18)30-24-16-11-21(26(29)20(3)28-27(4,5)6)17-25(24)31-23-14-9-19(2)10-15-23/h7-17,20,28H,1-6H3 |
| InChIKey | OJUWVGXNSFFIDE-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |