C22H29NO7S — CID 88754707
[5-[2-(tert-butylamino)acetyl]-2-(4-methylphenoxy)phenyl] acetate;methanesulfonic acid (PubChem CID 88754707) has the molecular formula C22H29NO7S and a molecular weight of 451.54 g/mol. Its IUPAC name is [5-[2-(tert-butylamino)acetyl]-2-(4-methylphenoxy)phenyl] acetate;methanesulfonic acid.
| Compound Name | [5-[2-(tert-butylamino)acetyl]-2-(4-methylphenoxy)phenyl] acetate;methanesulfonic acid |
|---|---|
| PubChem CID | 88754707 |
| Molecular Formula | C22H29NO7S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | [5-[2-(tert-butylamino)acetyl]-2-(4-methylphenoxy)phenyl] acetate;methanesulfonic acid |
| SMILES | CC(=O)Oc1cc(C(=O)CNC(C)(C)C)ccc1Oc1ccc(C)cc1.CS(=O)(=O)O |
| InChI | InChI=1S/C21H25NO4.CH4O3S/c1-14-6-9-17(10-7-14)26-19-11-8-16(12-20(19)25-15(2)23)18(24)13-22-21(3,4)5;1-5(2,3)4/h6-12,22H,13H2,1-5H3;1H3,(H,2,3,4) |
| InChIKey | PTAGHNHKOIKCRC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|