C34H41NO5 — CID 20535369
[4-[2-(tert-butylamino)acetyl]-2-(4-tert-butylbenzoyl)oxyphenyl] 4-tert-butylbenzoate (PubChem CID 20535369) has the molecular formula C34H41NO5 and a molecular weight of 543.70 g/mol. Its IUPAC name is [4-[2-(tert-butylamino)acetyl]-2-(4-tert-butylbenzoyl)oxyphenyl] 4-tert-butylbenzoate.
| Compound Name | [4-[2-(tert-butylamino)acetyl]-2-(4-tert-butylbenzoyl)oxyphenyl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 20535369 |
| Molecular Formula | C34H41NO5 |
| Molecular Weight | 543.70 g/mol |
| Exact Mass | 543.30 |
| IUPAC Name | [4-[2-(tert-butylamino)acetyl]-2-(4-tert-butylbenzoyl)oxyphenyl] 4-tert-butylbenzoate |
| SMILES | CC(C)(C)NCC(=O)c1ccc(OC(=O)c2ccc(C(C)(C)C)cc2)c(OC(=O)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C34H41NO5/c1-32(2,3)25-15-10-22(11-16-25)30(37)39-28-19-14-24(27(36)21-35-34(7,8)9)20-29(28)40-31(38)23-12-17-26(18-13-23)33(4,5)6/h10-20,35H,21H2,1-9H3 |
| InChIKey | HVLQIBWNVIWVGL-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.70 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|