C23H27NO5 — CID 13080807
[2-(acetyloxymethyl)-4-[2-(tert-butylamino)acetyl]phenyl] 2-methylbenzoate (PubChem CID 13080807) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is [2-(acetyloxymethyl)-4-[2-(tert-butylamino)acetyl]phenyl] 2-methylbenzoate.
| Compound Name | [2-(acetyloxymethyl)-4-[2-(tert-butylamino)acetyl]phenyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 13080807 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | [2-(acetyloxymethyl)-4-[2-(tert-butylamino)acetyl]phenyl] 2-methylbenzoate |
| SMILES | CC(=O)OCc1cc(C(=O)CNC(C)(C)C)ccc1OC(=O)c1ccccc1C |
| InChI | InChI=1S/C23H27NO5/c1-15-8-6-7-9-19(15)22(27)29-21-11-10-17(12-18(21)14-28-16(2)25)20(26)13-24-23(3,4)5/h6-12,24H,13-14H2,1-5H3 |
| InChIKey | UYMBKXNAXUEXTJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|