C23H27NO5 — CID 70553940
[2-(acetyloxymethyl)-4-(2-amino-3,3-dimethylbutanoyl)phenyl] 2-methylbenzoate (PubChem CID 70553940) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is [2-(acetyloxymethyl)-4-(2-amino-3,3-dimethylbutanoyl)phenyl] 2-methylbenzoate.
| Compound Name | [2-(acetyloxymethyl)-4-(2-amino-3,3-dimethylbutanoyl)phenyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 70553940 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | [2-(acetyloxymethyl)-4-(2-amino-3,3-dimethylbutanoyl)phenyl] 2-methylbenzoate |
| SMILES | CC(=O)OCc1cc(C(=O)C(N)C(C)(C)C)ccc1OC(=O)c1ccccc1C |
| InChI | InChI=1S/C23H27NO5/c1-14-8-6-7-9-18(14)22(27)29-19-11-10-16(12-17(19)13-28-15(2)25)20(26)21(24)23(3,4)5/h6-12,21H,13,24H2,1-5H3 |
| InChIKey | KTFXEGGPDYQRJO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|