C56H93NO5 — CID 54558238
[4-[2-(tert-butylamino)acetyl]-2-docosa-5,13-dienoyloxyphenyl] docosa-5,13-dienoate (PubChem CID 54558238) has the molecular formula C56H93NO5 and a molecular weight of 860.36 g/mol. Its IUPAC name is [4-[2-(tert-butylamino)acetyl]-2-docosa-5,13-dienoyloxyphenyl] docosa-5,13-dienoate.
| Compound Name | [4-[2-(tert-butylamino)acetyl]-2-docosa-5,13-dienoyloxyphenyl] docosa-5,13-dienoate |
|---|---|
| PubChem CID | 54558238 |
| Molecular Formula | C56H93NO5 |
| Molecular Weight | 860.36 g/mol |
| Exact Mass | 859.71 |
| IUPAC Name | [4-[2-(tert-butylamino)acetyl]-2-docosa-5,13-dienoyloxyphenyl] docosa-5,13-dienoate |
| SMILES | CCCCCCCCC=CCCCCCCC=CCCCC(=O)Oc1ccc(C(=O)CNC(C)(C)C)cc1OC(=O)CCCC=CCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C56H93NO5/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-40-42-44-54(59)61-52-47-46-50(51(58)49-57-56(3,4)5)48-53(52)62-55(60)45-43-41-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h20-23,36-39,46-48,57H,6-19,24-35,40-45,49H2,1-5H3 |
| InChIKey | ZORVDIFNXTZYGM-UHFFFAOYSA-N |
| XLogP | 16.82 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.36 |
| LogP ≤ 5 | 16.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|