C45H72O6 — CID 171463181
(E)-3-[3,4-bis[[(Z)-octadec-9-enoyl]oxy]phenyl]prop-2-enoic acid (PubChem CID 171463181) has the molecular formula C45H72O6 and a molecular weight of 709.07 g/mol. Its IUPAC name is (E)-3-[3,4-bis[[(Z)-octadec-9-enoyl]oxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,4-bis[[(Z)-octadec-9-enoyl]oxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 171463181 |
| Molecular Formula | C45H72O6 |
| Molecular Weight | 709.07 g/mol |
| Exact Mass | 708.53 |
| IUPAC Name | (E)-3-[3,4-bis[[(Z)-octadec-9-enoyl]oxy]phenyl]prop-2-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)Oc1ccc(/C=C/C(=O)O)cc1OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C45H72O6/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-44(48)50-41-37-35-40(36-38-43(46)47)39-42(41)51-45(49)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,35-39H,3-16,21-34H2,1-2H3,(H,46,47)/b19-17-,20-18-,38-36+ |
| InChIKey | HZWFCUNVBWCAIC-VAJZOOSRSA-N |
| XLogP | 13.67 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.07 |
| LogP ≤ 5 | 13.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|