C26H30O14S — CID 159103772
(E)-3-[3,4-di(butanoyloxy)phenyl]prop-2-enoic acid;(E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid;sulfuric acid (PubChem CID 159103772) has the molecular formula C26H30O14S and a molecular weight of 598.58 g/mol. Its IUPAC name is (E)-3-[3,4-di(butanoyloxy)phenyl]prop-2-enoic acid;(E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid;sulfuric acid.
| Compound Name | (E)-3-[3,4-di(butanoyloxy)phenyl]prop-2-enoic acid;(E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid;sulfuric acid |
|---|---|
| PubChem CID | 159103772 |
| Molecular Formula | C26H30O14S |
| Molecular Weight | 598.58 g/mol |
| Exact Mass | 598.14 |
| IUPAC Name | (E)-3-[3,4-di(butanoyloxy)phenyl]prop-2-enoic acid;(E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid;sulfuric acid |
| SMILES | CCCC(=O)Oc1ccc(/C=C/C(=O)O)cc1OC(=O)CCC.O=C(O)/C=C/c1ccc(O)c(O)c1.O=S(=O)(O)O |
| InChI | InChI=1S/C17H20O6.C9H8O4.H2O4S/c1-3-5-16(20)22-13-9-7-12(8-10-15(18)19)11-14(13)23-17(21)6-4-2;10-7-3-1-6(5-8(7)11)2-4-9(12)13;1-5(2,3)4/h7-11H,3-6H2,1-2H3,(H,18,19);1-5,10-11H,(H,12,13);(H2,1,2,3,4)/b10-8+;4-2+; |
| InChIKey | BTHXLNHXIMCFFA-APXCSSAQSA-N |
| XLogP | 3.74 |
| TPSA | 242.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|