C9H7NaO7S — CID 169435793
sodium [4-[(E)-2-carboxyethenyl]-2-hydroxyphenyl] sulfate (PubChem CID 169435793) has the molecular formula C9H7NaO7S and a molecular weight of 282.20 g/mol. Its IUPAC name is sodium [4-[(E)-2-carboxyethenyl]-2-hydroxyphenyl] sulfate.
| Compound Name | sodium [4-[(E)-2-carboxyethenyl]-2-hydroxyphenyl] sulfate |
|---|---|
| PubChem CID | 169435793 |
| Molecular Formula | C9H7NaO7S |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | sodium [4-[(E)-2-carboxyethenyl]-2-hydroxyphenyl] sulfate |
| SMILES | O=C(O)/C=C/c1ccc(OS(=O)(=O)[O-])c(O)c1.[Na+] |
| InChI | InChI=1S/C9H8O7S.Na/c10-7-5-6(2-4-9(11)12)1-3-8(7)16-17(13,14)15;/h1-5,10H,(H,11,12)(H,13,14,15);/q;+1/p-1/b4-2+; |
| InChIKey | NVQRXTIHMGDTJO-VEELZWTKSA-M |
| XLogP | -2.67 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|