C10H10O7S — CID 71376777
methyl 3-(3-hydroxy-4-sulfooxyphenyl)prop-2-enoate (PubChem CID 71376777) has the molecular formula C10H10O7S and a molecular weight of 274.25 g/mol. Its IUPAC name is methyl 3-(3-hydroxy-4-sulfooxyphenyl)prop-2-enoate.
| Compound Name | methyl 3-(3-hydroxy-4-sulfooxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 71376777 |
| Molecular Formula | C10H10O7S |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | methyl 3-(3-hydroxy-4-sulfooxyphenyl)prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccc(OS(=O)(=O)O)c(O)c1 |
| InChI | InChI=1S/C10H10O7S/c1-16-10(12)5-3-7-2-4-9(8(11)6-7)17-18(13,14)15/h2-6,11H,1H3,(H,13,14,15) |
| InChIKey | FAMHVGCNAFMKMZ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|