C13H19NO3 — CID 13080781
2-(tert-butylamino)-1-(3,4-dihydroxyphenyl)propan-1-one (PubChem CID 13080781) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-(tert-butylamino)-1-(3,4-dihydroxyphenyl)propan-1-one.
| Compound Name | 2-(tert-butylamino)-1-(3,4-dihydroxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 13080781 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 2-(tert-butylamino)-1-(3,4-dihydroxyphenyl)propan-1-one |
| SMILES | CC(NC(C)(C)C)C(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H19NO3/c1-8(14-13(2,3)4)12(17)9-5-6-10(15)11(16)7-9/h5-8,14-16H,1-4H3 |
| InChIKey | MXBUOKSIVLLYLM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|