C21H26ClNO9 — CID 131698964
bis((E)-but-2-enedioic acid);2-(tert-butylamino)-1-(4-chlorophenyl)propan-1-one (PubChem CID 131698964) has the molecular formula C21H26ClNO9 and a molecular weight of 471.89 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);2-(tert-butylamino)-1-(4-chlorophenyl)propan-1-one.
| Compound Name | bis((E)-but-2-enedioic acid);2-(tert-butylamino)-1-(4-chlorophenyl)propan-1-one |
|---|---|
| PubChem CID | 131698964 |
| Molecular Formula | C21H26ClNO9 |
| Molecular Weight | 471.89 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | bis((E)-but-2-enedioic acid);2-(tert-butylamino)-1-(4-chlorophenyl)propan-1-one |
| SMILES | CC(NC(C)(C)C)C(=O)c1ccc(Cl)cc1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C13H18ClNO.2C4H4O4/c1-9(15-13(2,3)4)12(16)10-5-7-11(14)8-6-10;2*5-3(6)1-2-4(7)8/h5-9,15H,1-4H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | HPADJAZYXDVHBG-LVEZLNDCSA-N |
| XLogP | 2.72 |
| TPSA | 178.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.89 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|