C13H19BrClNO — CID 73416165
(2S)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-one;hydrobromide (PubChem CID 73416165) has the molecular formula C13H19BrClNO and a molecular weight of 320.66 g/mol. Its IUPAC name is (2S)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-one;hydrobromide.
| Compound Name | (2S)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-one;hydrobromide |
|---|---|
| PubChem CID | 73416165 |
| Molecular Formula | C13H19BrClNO |
| Molecular Weight | 320.66 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | (2S)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-one;hydrobromide |
| SMILES | Br.C[C@H](NC(C)(C)C)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H18ClNO.BrH/c1-9(15-13(2,3)4)12(16)10-6-5-7-11(14)8-10;/h5-9,15H,1-4H3;1H/t9-;/m0./s1 |
| InChIKey | WSTCENNATOVXKQ-FVGYRXGTSA-N |
| XLogP | 3.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.66 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |