C13H18ClNO — CID 72950433
(2R)-2-(tert-butylamino)-1-(3-chlorophenyl)-2-deuteriopropan-1-one (PubChem CID 72950433) has the molecular formula C13H18ClNO and a molecular weight of 240.75 g/mol. Its IUPAC name is (2R)-2-(tert-butylamino)-1-(3-chlorophenyl)-2-deuteriopropan-1-one.
| Compound Name | (2R)-2-(tert-butylamino)-1-(3-chlorophenyl)-2-deuteriopropan-1-one |
|---|---|
| PubChem CID | 72950433 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 240.75 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | (2R)-2-(tert-butylamino)-1-(3-chlorophenyl)-2-deuteriopropan-1-one |
| SMILES | [2H][C@](C)(NC(C)(C)C)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H18ClNO/c1-9(15-13(2,3)4)12(16)10-6-5-7-11(14)8-10/h5-9,15H,1-4H3/t9-/m1/s1/i9D |
| InChIKey | SNPPWIUOZRMYNY-SFTFEADESA-N |
| XLogP | 3.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.75 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |